About 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine
1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine (PubChem CID 168954155) has the molecular formula C15H20ClN5
and a molecular weight of 305.81 g/mol. Its IUPAC name is 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine |
| PubChem CID | 168954155 |
| Molecular Formula | C15H20ClN5 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine |
| SMILES | Cc1nnc(Cl)c2cc(N3CCC(N(C)C)CC3)cnc12 |
| InChI | InChI=1S/C15H20ClN5/c1-10-14-13(15(16)19-18-10)8-12(9-17-14)21-6-4-11(5-7-21)20(2)3/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | KLPLWQBVAJQCOA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine?
The IUPAC name of 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine (CID 168954155) is 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine.
What is the SMILES notation for 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine?
The canonical SMILES for 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine is Cc1nnc(Cl)c2cc(N3CCC(N(C)C)CC3)cnc12.
What is the InChIKey of 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine?
The InChIKey is KLPLWQBVAJQCOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClN5/c1-10-14-13(15(16)19-18-10)8-12(9-17-14)21-6-4-11(5-7-21)20(2)3/h8-9,11H,4-7H2,1-3H3.
What are the key properties of 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine?
1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine has a molecular weight of 305.81 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-8-methylpyrido[2,3-d]pyridazin-3-yl)-N,N-dimethylpiperidin-4-amine is sourced from PubChem (CID 168954155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).