C38H49NO — CID 123855221
7,10-bis(4-tert-butylphenyl)-5-ethyl-4-(oxan-2-yl)-2,3,4,5-tetrahydro-1-benzazocine (PubChem CID 123855221) has the molecular formula C38H49NO and a molecular weight of 535.82 g/mol. Its IUPAC name is 7,10-bis(4-tert-butylphenyl)-5-ethyl-4-(oxan-2-yl)-2,3,4,5-tetrahydro-1-benzazocine.
| Compound Name | 7,10-bis(4-tert-butylphenyl)-5-ethyl-4-(oxan-2-yl)-2,3,4,5-tetrahydro-1-benzazocine |
|---|---|
| PubChem CID | 123855221 |
| Molecular Formula | C38H49NO |
| Molecular Weight | 535.82 g/mol |
| Exact Mass | 535.38 |
| IUPAC Name | 7,10-bis(4-tert-butylphenyl)-5-ethyl-4-(oxan-2-yl)-2,3,4,5-tetrahydro-1-benzazocine |
| SMILES | CCC1C=c2c(-c3ccc(C(C)(C)C)cc3)ccc(-c3ccc(C(C)(C)C)cc3)/c2=N/CCC1C1CCCCO1 |
| InChI | InChI=1S/C38H49NO/c1-8-26-25-34-31(27-12-16-29(17-13-27)37(2,3)4)20-21-33(28-14-18-30(19-15-28)38(5,6)7)36(34)39-23-22-32(26)35-11-9-10-24-40-35/h12-21,25-26,32,35H,8-11,22-24H2,1-7H3/b34-25?,39-36- |
| InChIKey | NZKLIDQOMUUPNB-GLWRTHKPSA-N |
| XLogP | 8.63 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.82 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |