C24H31NO — CID 7390371
N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]-1-phenylmethanimine (PubChem CID 7390371) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]-1-phenylmethanimine.
| Compound Name | N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 7390371 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]-1-phenylmethanimine |
| SMILES | Cc1ccc([C@@H](CC/N=C/c2ccccc2)[C@@H]2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C24H31NO/c1-19-9-11-21(12-10-19)23(22-14-16-26-24(2,3)17-22)13-15-25-18-20-7-5-4-6-8-20/h4-12,18,22-23H,13-17H2,1-3H3/b25-18+/t22-,23-/m1/s1 |
| InChIKey | AZIRMXJZJODAMB-UUPNMYHRSA-N |
| XLogP | 5.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|