C23H29NO — CID 4311167
N-[2-(4-benzyl-2,2-dimethyloxan-4-yl)ethyl]-1-phenylmethanimine (PubChem CID 4311167) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is N-[2-(4-benzyl-2,2-dimethyloxan-4-yl)ethyl]-1-phenylmethanimine.
| Compound Name | N-[2-(4-benzyl-2,2-dimethyloxan-4-yl)ethyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 4311167 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | N-[2-(4-benzyl-2,2-dimethyloxan-4-yl)ethyl]-1-phenylmethanimine |
| SMILES | CC1(C)CC(CC/N=C/c2ccccc2)(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C23H29NO/c1-22(2)19-23(14-16-25-22,17-20-9-5-3-6-10-20)13-15-24-18-21-11-7-4-8-12-21/h3-12,18H,13-17,19H2,1-2H3/b24-18+ |
| InChIKey | LNVBUCUMDVWOPT-HKOYGPOVSA-N |
| XLogP | 5.31 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|