C23H28FNO — CID 7098368
N-[(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)propyl]-1-phenylmethanimine (PubChem CID 7098368) has the molecular formula C23H28FNO and a molecular weight of 353.48 g/mol. Its IUPAC name is N-[(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)propyl]-1-phenylmethanimine.
| Compound Name | N-[(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)propyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 7098368 |
| Molecular Formula | C23H28FNO |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | N-[(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-fluorophenyl)propyl]-1-phenylmethanimine |
| SMILES | CC1(C)C[C@H]([C@@H](CC/N=C/c2ccccc2)c2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C23H28FNO/c1-23(2)16-20(13-15-26-23)22(19-8-10-21(24)11-9-19)12-14-25-17-18-6-4-3-5-7-18/h3-11,17,20,22H,12-16H2,1-2H3/b25-17+/t20-,22+/m1/s1 |
| InChIKey | WDBMCHUCIZNYQQ-URQYPFBASA-N |
| XLogP | 5.62 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|