C32H32N6O7S — CID 123856217
methyl 5-[[4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylimidazole-2-carbonyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 123856217) has the molecular formula C32H32N6O7S and a molecular weight of 644.71 g/mol. Its IUPAC name is methyl 5-[[4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylimidazole-2-carbonyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-[[4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylimidazole-2-carbonyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 123856217 |
| Molecular Formula | C32H32N6O7S |
| Molecular Weight | 644.71 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | methyl 5-[[4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylimidazole-2-carbonyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(NC(=O)c3nc(NC(=O)CCCOc4cc5c(cc4OC)C(=O)N4CCCC4C=N5)cn3C)ccc2s1 |
| InChI | InChI=1S/C32H32N6O7S/c1-37-17-27(36-29(37)30(40)34-19-8-9-25-18(12-19)13-26(46-25)32(42)44-3)35-28(39)7-5-11-45-24-15-22-21(14-23(24)43-2)31(41)38-10-4-6-20(38)16-33-22/h8-9,12-17,20H,4-7,10-11H2,1-3H3,(H,34,40)(H,35,39) |
| InChIKey | QTSCEKLCDKJMMR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 153.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|