C23H20ClFN4O4 — CID 123859017
methyl 2-amino-5-[[6-chloro-3-(2,3-dihydro-1-benzofuran-5-ylmethoxy)-2-fluorobenzoyl]amino]pyridine-3-carboximidate (PubChem CID 123859017) has the molecular formula C23H20ClFN4O4 and a molecular weight of 470.89 g/mol. Its IUPAC name is methyl 2-amino-5-[[6-chloro-3-(2,3-dihydro-1-benzofuran-5-ylmethoxy)-2-fluorobenzoyl]amino]pyridine-3-carboximidate.
| Compound Name | methyl 2-amino-5-[[6-chloro-3-(2,3-dihydro-1-benzofuran-5-ylmethoxy)-2-fluorobenzoyl]amino]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 123859017 |
| Molecular Formula | C23H20ClFN4O4 |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | methyl 2-amino-5-[[6-chloro-3-(2,3-dihydro-1-benzofuran-5-ylmethoxy)-2-fluorobenzoyl]amino]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OC)c1cc(NC(=O)c2c(Cl)ccc(OCc3ccc4c(c3)CCO4)c2F)cnc1N |
| InChI | InChI=1S/C23H20ClFN4O4/c1-31-22(27)15-9-14(10-28-21(15)26)29-23(30)19-16(24)3-5-18(20(19)25)33-11-12-2-4-17-13(8-12)6-7-32-17/h2-5,8-10,27H,6-7,11H2,1H3,(H2,26,28)(H,29,30)/b27-22- |
| InChIKey | RCRVKTLAQNZGJR-QYQHSDTDSA-N |
| XLogP | 4.19 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|