C12H17NO3S — CID 123860878
3-(cyclopropylmethoxy)-6-ethylsulfonyl-2-methylpyridine (PubChem CID 123860878) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-6-ethylsulfonyl-2-methylpyridine.
| Compound Name | 3-(cyclopropylmethoxy)-6-ethylsulfonyl-2-methylpyridine |
|---|---|
| PubChem CID | 123860878 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-(cyclopropylmethoxy)-6-ethylsulfonyl-2-methylpyridine |
| SMILES | CCS(=O)(=O)c1ccc(OCC2CC2)c(C)n1 |
| InChI | InChI=1S/C12H17NO3S/c1-3-17(14,15)12-7-6-11(9(2)13-12)16-8-10-4-5-10/h6-7,10H,3-5,8H2,1-2H3 |
| InChIKey | ZCMDRVBYDFTMPD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |