About 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane
2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane (PubChem CID 123861215) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane.
Molecular Properties
| Compound Name | 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane |
| PubChem CID | 123861215 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane |
| SMILES | CCCCCCC(C1CC1)C1C(C)CC1C |
| InChI | InChI=1S/C16H30/c1-4-5-6-7-8-15(14-9-10-14)16-12(2)11-13(16)3/h12-16H,4-11H2,1-3H3 |
| InChIKey | QKSOGEYGISRVOU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane?
The IUPAC name of 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane (CID 123861215) is 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane.
What is the SMILES notation for 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane?
The canonical SMILES for 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane is CCCCCCC(C1CC1)C1C(C)CC1C.
What is the InChIKey of 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane?
The InChIKey is QKSOGEYGISRVOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30/c1-4-5-6-7-8-15(14-9-10-14)16-12(2)11-13(16)3/h12-16H,4-11H2,1-3H3.
What are the key properties of 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane?
2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane has a molecular weight of 222.42 g/mol, XLogP of 5.28, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopropylheptyl)-1,3-dimethylcyclobutane is sourced from PubChem (CID 123861215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).