C9H13N — CID 123861610
2,5,6-trimethyl-4H-azepine (PubChem CID 123861610) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 2,5,6-trimethyl-4H-azepine.
| Compound Name | 2,5,6-trimethyl-4H-azepine |
|---|---|
| PubChem CID | 123861610 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2,5,6-trimethyl-4H-azepine |
| SMILES | CC1=CCC(C)=C(C)C=N1 |
| InChI | InChI=1S/C9H13N/c1-7-4-5-9(3)10-6-8(7)2/h5-6H,4H2,1-3H3 |
| InChIKey | CCNHMOSPSPHJBE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |