C22H20ClFN2O5 — CID 123862018
N-[(3-chloro-2-fluorophenyl)methyl]-7-hydroxy-5a-methyl-6,8-dioxo-2,5,12,12a-tetrahydrooxepino[3,2-b]quinolizine-9-carboxamide (PubChem CID 123862018) has the molecular formula C22H20ClFN2O5 and a molecular weight of 446.86 g/mol. Its IUPAC name is N-[(3-chloro-2-fluorophenyl)methyl]-7-hydroxy-5a-methyl-6,8-dioxo-2,5,12,12a-tetrahydrooxepino[3,2-b]quinolizine-9-carboxamide.
| Compound Name | N-[(3-chloro-2-fluorophenyl)methyl]-7-hydroxy-5a-methyl-6,8-dioxo-2,5,12,12a-tetrahydrooxepino[3,2-b]quinolizine-9-carboxamide |
|---|---|
| PubChem CID | 123862018 |
| Molecular Formula | C22H20ClFN2O5 |
| Molecular Weight | 446.86 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-[(3-chloro-2-fluorophenyl)methyl]-7-hydroxy-5a-methyl-6,8-dioxo-2,5,12,12a-tetrahydrooxepino[3,2-b]quinolizine-9-carboxamide |
| SMILES | CC12CC=CCOC1Cn1cc(C(=O)NCc3cccc(Cl)c3F)c(=O)c(O)c1C2=O |
| InChI | InChI=1S/C22H20ClFN2O5/c1-22-7-2-3-8-31-15(22)11-26-10-13(18(27)19(28)17(26)20(22)29)21(30)25-9-12-5-4-6-14(23)16(12)24/h2-6,10,15,28H,7-9,11H2,1H3,(H,25,30) |
| InChIKey | DDLYRDSPIWLHNI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.86 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|