C19H18ClFN4O5 — CID 139427034
N-[(3-chloro-2-fluorophenyl)methyl]-6-hydroxy-5,8-dioxo-12-oxa-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide (PubChem CID 139427034) has the molecular formula C19H18ClFN4O5 and a molecular weight of 436.83 g/mol. Its IUPAC name is N-[(3-chloro-2-fluorophenyl)methyl]-6-hydroxy-5,8-dioxo-12-oxa-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide.
| Compound Name | N-[(3-chloro-2-fluorophenyl)methyl]-6-hydroxy-5,8-dioxo-12-oxa-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 139427034 |
| Molecular Formula | C19H18ClFN4O5 |
| Molecular Weight | 436.83 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-[(3-chloro-2-fluorophenyl)methyl]-6-hydroxy-5,8-dioxo-12-oxa-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1F)c1cn2c(c(O)c1=O)C(=O)N1CCOCCN2C1 |
| InChI | InChI=1S/C19H18ClFN4O5/c20-13-3-1-2-11(14(13)21)8-22-18(28)12-9-25-15(17(27)16(12)26)19(29)23-4-6-30-7-5-24(25)10-23/h1-3,9,27H,4-8,10H2,(H,22,28) |
| InChIKey | NETFFXAWLCCCMD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.83 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |