C26H35N5O5S — CID 123862370
N-[[4-[4-[(2-methylpropan-2-yl)oxymethoxymethylamino]piperidin-1-yl]sulfonylphenyl]methyl]imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 123862370) has the molecular formula C26H35N5O5S and a molecular weight of 529.66 g/mol. Its IUPAC name is N-[[4-[4-[(2-methylpropan-2-yl)oxymethoxymethylamino]piperidin-1-yl]sulfonylphenyl]methyl]imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-[[4-[4-[(2-methylpropan-2-yl)oxymethoxymethylamino]piperidin-1-yl]sulfonylphenyl]methyl]imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 123862370 |
| Molecular Formula | C26H35N5O5S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | N-[[4-[4-[(2-methylpropan-2-yl)oxymethoxymethylamino]piperidin-1-yl]sulfonylphenyl]methyl]imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CC(C)(C)OCOCNC1CCN(S(=O)(=O)c2ccc(CNC(=O)c3ccc4nccn4c3)cc2)CC1 |
| InChI | InChI=1S/C26H35N5O5S/c1-26(2,3)36-19-35-18-29-22-10-13-31(14-11-22)37(33,34)23-7-4-20(5-8-23)16-28-25(32)21-6-9-24-27-12-15-30(24)17-21/h4-9,12,15,17,22,29H,10-11,13-14,16,18-19H2,1-3H3,(H,28,32) |
| InChIKey | CPZDCWNYSMSQCY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|