C26H31N5O5S — CID 90011983
tert-butyl 5-[4-[(imidazo[1,2-a]pyridine-6-carbonylamino)methyl]phenyl]sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate (PubChem CID 90011983) has the molecular formula C26H31N5O5S and a molecular weight of 525.63 g/mol. Its IUPAC name is tert-butyl 5-[4-[(imidazo[1,2-a]pyridine-6-carbonylamino)methyl]phenyl]sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 5-[4-[(imidazo[1,2-a]pyridine-6-carbonylamino)methyl]phenyl]sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 90011983 |
| Molecular Formula | C26H31N5O5S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | tert-butyl 5-[4-[(imidazo[1,2-a]pyridine-6-carbonylamino)methyl]phenyl]sulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2CN(S(=O)(=O)c3ccc(CNC(=O)c4ccc5nccn5c4)cc3)CC21 |
| InChI | InChI=1S/C26H31N5O5S/c1-26(2,3)36-25(33)31-12-10-19-16-30(17-22(19)31)37(34,35)21-7-4-18(5-8-21)14-28-24(32)20-6-9-23-27-11-13-29(23)15-20/h4-9,11,13,15,19,22H,10,12,14,16-17H2,1-3H3,(H,28,32) |
| InChIKey | ZJRDREPDGDNEES-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |