C13H21F4NO5S — CID 123863906
tert-butyl 3-fluoro-3-[2-(trifluoromethylsulfonyloxy)ethyl]piperidine-1-carboxylate (PubChem CID 123863906) has the molecular formula C13H21F4NO5S and a molecular weight of 379.37 g/mol. Its IUPAC name is tert-butyl 3-fluoro-3-[2-(trifluoromethylsulfonyloxy)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-3-[2-(trifluoromethylsulfonyloxy)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123863906 |
| Molecular Formula | C13H21F4NO5S |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | tert-butyl 3-fluoro-3-[2-(trifluoromethylsulfonyloxy)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(F)(CCOS(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H21F4NO5S/c1-11(2,3)23-10(19)18-7-4-5-12(14,9-18)6-8-22-24(20,21)13(15,16)17/h4-9H2,1-3H3 |
| InChIKey | JLGIRAIRTFKCKR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|