C11H21N3O4S — CID 123864263
(3S)-3-[[(2S)-2-hydrazinyl-4-methylsulfanylbutanoyl]amino]-4-methyl-2-oxopentanoic acid (PubChem CID 123864263) has the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-hydrazinyl-4-methylsulfanylbutanoyl]amino]-4-methyl-2-oxopentanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-hydrazinyl-4-methylsulfanylbutanoyl]amino]-4-methyl-2-oxopentanoic acid |
|---|---|
| PubChem CID | 123864263 |
| Molecular Formula | C11H21N3O4S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (3S)-3-[[(2S)-2-hydrazinyl-4-methylsulfanylbutanoyl]amino]-4-methyl-2-oxopentanoic acid |
| SMILES | CSCC[C@H](NN)C(=O)N[C@H](C(=O)C(=O)O)C(C)C |
| InChI | InChI=1S/C11H21N3O4S/c1-6(2)8(9(15)11(17)18)13-10(16)7(14-12)4-5-19-3/h6-8,14H,4-5,12H2,1-3H3,(H,13,16)(H,17,18)/t7-,8-/m0/s1 |
| InChIKey | QKXOUIRTSGQPHG-YUMQZZPRSA-N |
| XLogP | -0.63 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|