C34H47F2N5O3 — CID 123864640
2,4-difluoro-N-[1-[[5-methyl-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]-[4-(propan-2-ylcarbamoyl)cyclohexyl]amino]butylidene]benzamide (PubChem CID 123864640) has the molecular formula C34H47F2N5O3 and a molecular weight of 611.78 g/mol. Its IUPAC name is 2,4-difluoro-N-[1-[[5-methyl-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]-[4-(propan-2-ylcarbamoyl)cyclohexyl]amino]butylidene]benzamide.
| Compound Name | 2,4-difluoro-N-[1-[[5-methyl-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]-[4-(propan-2-ylcarbamoyl)cyclohexyl]amino]butylidene]benzamide |
|---|---|
| PubChem CID | 123864640 |
| Molecular Formula | C34H47F2N5O3 |
| Molecular Weight | 611.78 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | 2,4-difluoro-N-[1-[[5-methyl-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]-[4-(propan-2-ylcarbamoyl)cyclohexyl]amino]butylidene]benzamide |
| SMILES | CCC/C(=N\C(=O)c1ccc(F)cc1F)N(c1cc(OCCN2CCCCC2)ncc1C)C1CCC(C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C34H47F2N5O3/c1-5-9-31(39-34(43)28-15-12-26(35)20-29(28)36)41(27-13-10-25(11-14-27)33(42)38-23(2)3)30-21-32(37-22-24(30)4)44-19-18-40-16-7-6-8-17-40/h12,15,20-23,25,27H,5-11,13-14,16-19H2,1-4H3,(H,38,42)/b39-31+ |
| InChIKey | UKXYICTVAADLHB-KGHBKMJJSA-N |
| XLogP | 6.46 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.78 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|