C29H26F3N5O3 — CID 123865103
benzyl 4-(4-cyanophenyl)-2-[2-(methoxymethyl)hydrazinyl]-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate (PubChem CID 123865103) has the molecular formula C29H26F3N5O3 and a molecular weight of 549.55 g/mol. Its IUPAC name is benzyl 4-(4-cyanophenyl)-2-[2-(methoxymethyl)hydrazinyl]-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate.
| Compound Name | benzyl 4-(4-cyanophenyl)-2-[2-(methoxymethyl)hydrazinyl]-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 123865103 |
| Molecular Formula | C29H26F3N5O3 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | benzyl 4-(4-cyanophenyl)-2-[2-(methoxymethyl)hydrazinyl]-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
| SMILES | COCNNC1=NC(c2ccc(C#N)cc2)C(C(=O)OCc2ccccc2)=C(C)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H26F3N5O3/c1-19-25(27(38)40-17-21-7-4-3-5-8-21)26(22-13-11-20(16-33)12-14-22)35-28(36-34-18-39-2)37(19)24-10-6-9-23(15-24)29(30,31)32/h3-15,26,34H,17-18H2,1-2H3,(H,35,36) |
| InChIKey | UBZADMQSDQWLND-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|