C42H60F3N5O2S2 — CID 143437696
ethyl 4-(4-cyanophenyl)-6-methyl-2-[5-[10-(5-sulfanylpentylamino)decylamino]pentylsulfanyl]-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate (PubChem CID 143437696) has the molecular formula C42H60F3N5O2S2 and a molecular weight of 788.10 g/mol. Its IUPAC name is ethyl 4-(4-cyanophenyl)-6-methyl-2-[5-[10-(5-sulfanylpentylamino)decylamino]pentylsulfanyl]-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-cyanophenyl)-6-methyl-2-[5-[10-(5-sulfanylpentylamino)decylamino]pentylsulfanyl]-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 143437696 |
| Molecular Formula | C42H60F3N5O2S2 |
| Molecular Weight | 788.10 g/mol |
| Exact Mass | 787.41 |
| IUPAC Name | ethyl 4-(4-cyanophenyl)-6-methyl-2-[5-[10-(5-sulfanylpentylamino)decylamino]pentylsulfanyl]-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2cccc(C(F)(F)F)c2)C(SCCCCCNCCCCCCCCCCNCCCCCS)=NC1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C42H60F3N5O2S2/c1-3-52-40(51)38-33(2)50(37-20-18-19-36(31-37)42(43,44)45)41(49-39(38)35-23-21-34(32-46)22-24-35)54-30-17-11-15-28-48-26-13-9-7-5-4-6-8-12-25-47-27-14-10-16-29-53/h18-24,31,39,47-48,53H,3-17,25-30H2,1-2H3 |
| InChIKey | OOSFZLVOYIJBCE-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.10 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|