C20H12N3S+ — CID 123867081
22-thia-4,9-diaza-11-azoniahexacyclo[11.11.0.02,11.05,10.015,23.016,21]tetracosa-1(24),2,4,6,8,10,13,15(23),16,18,20-undecaene (PubChem CID 123867081) has the molecular formula C20H12N3S+ and a molecular weight of 326.40 g/mol. Its IUPAC name is 22-thia-4,9-diaza-11-azoniahexacyclo[11.11.0.02,11.05,10.015,23.016,21]tetracosa-1(24),2,4,6,8,10,13,15(23),16,18,20-undecaene.
| Compound Name | 22-thia-4,9-diaza-11-azoniahexacyclo[11.11.0.02,11.05,10.015,23.016,21]tetracosa-1(24),2,4,6,8,10,13,15(23),16,18,20-undecaene |
|---|---|
| PubChem CID | 123867081 |
| Molecular Formula | C20H12N3S+ |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 22-thia-4,9-diaza-11-azoniahexacyclo[11.11.0.02,11.05,10.015,23.016,21]tetracosa-1(24),2,4,6,8,10,13,15(23),16,18,20-undecaene |
| SMILES | c1cnc2c(c1)ncc1[n+]2Cc2cc3c(cc2-1)sc1ccccc13 |
| InChI | InChI=1S/C20H12N3S/c1-2-6-18-13(4-1)15-8-12-11-23-17(14(12)9-19(15)24-18)10-22-16-5-3-7-21-20(16)23/h1-10H,11H2/q+1 |
| InChIKey | HEQNOZGWVOXECS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|