C31H50O12 — CID 123869751
2-[5-methyl-4-oxo-7-[2-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]heptylidene]cyclopent-4-ene-1,3-dione (PubChem CID 123869751) has the molecular formula C31H50O12 and a molecular weight of 614.73 g/mol. Its IUPAC name is 2-[5-methyl-4-oxo-7-[2-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]heptylidene]cyclopent-4-ene-1,3-dione.
| Compound Name | 2-[5-methyl-4-oxo-7-[2-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]heptylidene]cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 123869751 |
| Molecular Formula | C31H50O12 |
| Molecular Weight | 614.73 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | 2-[5-methyl-4-oxo-7-[2-[2-[2-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]heptylidene]cyclopent-4-ene-1,3-dione |
| SMILES | CC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCC(C)C(=O)CCC=C1C(=O)C=CC1=O |
| InChI | InChI=1S/C31H50O12/c1-26(29(33)5-3-4-28-30(34)6-7-31(28)35)8-10-36-12-14-38-16-18-40-20-22-42-24-25-43-23-21-41-19-17-39-15-13-37-11-9-27(2)32/h4,6-7,26H,3,5,8-25H2,1-2H3 |
| InChIKey | RXEZDXPNLWCFOC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.73 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|