C21H34O4 — CID 90796572
13-methyl-1,4-dioxacyclodocosa-10,17-diene-8,19-dione (PubChem CID 90796572) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is 13-methyl-1,4-dioxacyclodocosa-10,17-diene-8,19-dione.
| Compound Name | 13-methyl-1,4-dioxacyclodocosa-10,17-diene-8,19-dione |
|---|---|
| PubChem CID | 90796572 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 13-methyl-1,4-dioxacyclodocosa-10,17-diene-8,19-dione |
| SMILES | CC1CC=CCC(=O)CCCOCCOCCCC(=O)C=CCCC1 |
| InChI | InChI=1S/C21H34O4/c1-19-9-3-2-4-11-20(22)13-7-15-24-17-18-25-16-8-14-21(23)12-6-5-10-19/h4-6,11,19H,2-3,7-10,12-18H2,1H3 |
| InChIKey | JEZRQWMSDWOJCX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|