C21H34O4 — CID 10193612
(9E,17E)-13-methyl-1,4-dioxacyclodocosa-9,17-diene-8,19-dione (PubChem CID 10193612) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (9E,17E)-13-methyl-1,4-dioxacyclodocosa-9,17-diene-8,19-dione.
| Compound Name | (9E,17E)-13-methyl-1,4-dioxacyclodocosa-9,17-diene-8,19-dione |
|---|---|
| PubChem CID | 10193612 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (9E,17E)-13-methyl-1,4-dioxacyclodocosa-9,17-diene-8,19-dione |
| SMILES | CC1CC/C=C/C(=O)CCCOCCOCCCC(=O)/C=C/CCC1 |
| InChI | InChI=1S/C21H34O4/c1-19-9-3-2-4-11-20(22)13-7-15-24-17-18-25-16-8-14-21(23)12-6-5-10-19/h4,6,11-12,19H,2-3,5,7-10,13-18H2,1H3/b11-4+,12-6+ |
| InChIKey | RVAUITSMKVWWOK-RYYWOMKVSA-N |
| XLogP | 4.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |