C20H32O4 — CID 90846625
1,4-dioxacyclodocosa-10,17-diene-8,19-dione (PubChem CID 90846625) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 1,4-dioxacyclodocosa-10,17-diene-8,19-dione.
| Compound Name | 1,4-dioxacyclodocosa-10,17-diene-8,19-dione |
|---|---|
| PubChem CID | 90846625 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 1,4-dioxacyclodocosa-10,17-diene-8,19-dione |
| SMILES | O=C1C=CCCCCCC=CCC(=O)CCCOCCOCCC1 |
| InChI | InChI=1S/C20H32O4/c21-19-11-7-5-3-1-2-4-6-8-12-20(22)14-10-16-24-18-17-23-15-9-13-19/h5,7-8,12H,1-4,6,9-11,13-18H2 |
| InChIKey | TXWRIWVWHIEVGL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|