C33H48O5 — CID 157311326
carbon dioxide;(7Z,10Z,13Z,16Z,19Z,22Z)-1-[(E)-4-oxohept-5-enoxy]pentacosa-7,10,13,16,19,22-hexaen-4-one (PubChem CID 157311326) has the molecular formula C33H48O5 and a molecular weight of 524.74 g/mol. Its IUPAC name is carbon dioxide;(7Z,10Z,13Z,16Z,19Z,22Z)-1-[(E)-4-oxohept-5-enoxy]pentacosa-7,10,13,16,19,22-hexaen-4-one.
| Compound Name | carbon dioxide;(7Z,10Z,13Z,16Z,19Z,22Z)-1-[(E)-4-oxohept-5-enoxy]pentacosa-7,10,13,16,19,22-hexaen-4-one |
|---|---|
| PubChem CID | 157311326 |
| Molecular Formula | C33H48O5 |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | carbon dioxide;(7Z,10Z,13Z,16Z,19Z,22Z)-1-[(E)-4-oxohept-5-enoxy]pentacosa-7,10,13,16,19,22-hexaen-4-one |
| SMILES | C/C=C/C(=O)CCCOCCCC(=O)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC.O=C=O |
| InChI | InChI=1S/C32H48O3.CO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26-32(34)28-24-30-35-29-23-27-31(33)25-4-2;2-1-3/h4-6,8-9,11-12,14-15,17-18,20-21,25H,3,7,10,13,16,19,22-24,26-30H2,1-2H3;/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20-,25-4+; |
| InChIKey | BDBNZZZTVJLSBQ-ALEVWDJMSA-N |
| XLogP | 8.17 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|