C29H28ClFN4O2 — CID 123870204
2-methylpropyl 1-[3-(2-chloro-4-pyridinyl)-4-(4-fluorophenyl)-2,6-naphthyridin-1-yl]piperidine-4-carboxylate (PubChem CID 123870204) has the molecular formula C29H28ClFN4O2 and a molecular weight of 519.02 g/mol. Its IUPAC name is 2-methylpropyl 1-[3-(2-chloro-4-pyridinyl)-4-(4-fluorophenyl)-2,6-naphthyridin-1-yl]piperidine-4-carboxylate.
| Compound Name | 2-methylpropyl 1-[3-(2-chloro-4-pyridinyl)-4-(4-fluorophenyl)-2,6-naphthyridin-1-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 123870204 |
| Molecular Formula | C29H28ClFN4O2 |
| Molecular Weight | 519.02 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 2-methylpropyl 1-[3-(2-chloro-4-pyridinyl)-4-(4-fluorophenyl)-2,6-naphthyridin-1-yl]piperidine-4-carboxylate |
| SMILES | CC(C)COC(=O)C1CCN(c2nc(-c3ccnc(Cl)c3)c(-c3ccc(F)cc3)c3cnccc23)CC1 |
| InChI | InChI=1S/C29H28ClFN4O2/c1-18(2)17-37-29(36)20-9-13-35(14-10-20)28-23-8-11-32-16-24(23)26(19-3-5-22(31)6-4-19)27(34-28)21-7-12-33-25(30)15-21/h3-8,11-12,15-16,18,20H,9-10,13-14,17H2,1-2H3 |
| InChIKey | CGEXYWLSCPNKHU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.02 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|