C19H26BF2N3O2 — CID 123871021
2-(4,4-difluoropyrrolidin-2-yl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 123871021) has the molecular formula C19H26BF2N3O2 and a molecular weight of 377.24 g/mol. Its IUPAC name is 2-(4,4-difluoropyrrolidin-2-yl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-(4,4-difluoropyrrolidin-2-yl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 123871021 |
| Molecular Formula | C19H26BF2N3O2 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-(4,4-difluoropyrrolidin-2-yl)-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | CC1(C)OB(c2ccc(C3CN=C(C4CC(F)(F)CN4)N3)cc2)OC1(C)C |
| InChI | InChI=1S/C19H26BF2N3O2/c1-17(2)18(3,4)27-20(26-17)13-7-5-12(6-8-13)15-10-23-16(25-15)14-9-19(21,22)11-24-14/h5-8,14-15,24H,9-11H2,1-4H3,(H,23,25) |
| InChIKey | WETISDJKGVVXQA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|