C17H25BN2O2 — CID 163503217
2,5-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 163503217) has the molecular formula C17H25BN2O2 and a molecular weight of 300.21 g/mol. Its IUPAC name is 2,5-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2,5-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 163503217 |
| Molecular Formula | C17H25BN2O2 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2,5-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | CC1=NC(c2cccc(B3OC(C)(C)C(C)(C)O3)c2)C(C)N1 |
| InChI | InChI=1S/C17H25BN2O2/c1-11-15(20-12(2)19-11)13-8-7-9-14(10-13)18-21-16(3,4)17(5,6)22-18/h7-11,15H,1-6H3,(H,19,20) |
| InChIKey | CWMSYSYYKZRMKZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|