C20H30BN3O2 — CID 123397133
2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]piperidine (PubChem CID 123397133) has the molecular formula C20H30BN3O2 and a molecular weight of 355.29 g/mol. Its IUPAC name is 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]piperidine.
| Compound Name | 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]piperidine |
|---|---|
| PubChem CID | 123397133 |
| Molecular Formula | C20H30BN3O2 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]piperidine |
| SMILES | CC1(C)OB(c2ccc(C3=NC(C4CCCCN4)NC3)cc2)OC1(C)C |
| InChI | InChI=1S/C20H30BN3O2/c1-19(2)20(3,4)26-21(25-19)15-10-8-14(9-11-15)17-13-23-18(24-17)16-7-5-6-12-22-16/h8-11,16,18,22-23H,5-7,12-13H2,1-4H3 |
| InChIKey | XMKMETARFNMCNK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|