C18H29BN2O2 — CID 99738254
(3S)-1-methyl-3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine (PubChem CID 99738254) has the molecular formula C18H29BN2O2 and a molecular weight of 316.25 g/mol. Its IUPAC name is (3S)-1-methyl-3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine.
| Compound Name | (3S)-1-methyl-3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 99738254 |
| Molecular Formula | C18H29BN2O2 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (3S)-1-methyl-3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine |
| SMILES | CN1CCN[C@@H](Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C18H29BN2O2/c1-17(2)18(3,4)23-19(22-17)15-8-6-14(7-9-15)12-16-13-21(5)11-10-20-16/h6-9,16,20H,10-13H2,1-5H3/t16-/m0/s1 |
| InChIKey | FUFLKGHSJWMHBW-INIZCTEOSA-N |
| XLogP | 1.43 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|