C15H23BN2O2 — CID 123942499
N-ethyl-2-imino-2-[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine (PubChem CID 123942499) has the molecular formula C15H23BN2O2 and a molecular weight of 274.17 g/mol. Its IUPAC name is N-ethyl-2-imino-2-[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine.
| Compound Name | N-ethyl-2-imino-2-[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 123942499 |
| Molecular Formula | C15H23BN2O2 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-ethyl-2-imino-2-[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine |
| SMILES | [H]/N=C(\CNCC)c1ccc(B2OC(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C15H23BN2O2/c1-5-18-10-14(17)12-6-8-13(9-7-12)16-19-11(2)15(3,4)20-16/h6-9,11,17-18H,5,10H2,1-4H3/b17-14+ |
| InChIKey | ZMXHNGLVLZKPLJ-SAPNQHFASA-N |
| XLogP | 1.57 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|