C18H30BNO2 — CID 171855041
N-propan-2-yl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-amine (PubChem CID 171855041) has the molecular formula C18H30BNO2 and a molecular weight of 303.26 g/mol. Its IUPAC name is N-propan-2-yl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-amine.
| Compound Name | N-propan-2-yl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 171855041 |
| Molecular Formula | C18H30BNO2 |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | N-propan-2-yl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-amine |
| SMILES | CC(C)NC(C)Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C18H30BNO2/c1-13(2)20-14(3)12-15-8-10-16(11-9-15)19-21-17(4,5)18(6,7)22-19/h8-11,13-14,20H,12H2,1-7H3 |
| InChIKey | LTONMDLOFCGXSM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|