C12H16N2O — CID 82396551
(E)-N-methoxy-1-phenyl-1-pyrrolidin-2-ylmethanimine (PubChem CID 82396551) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (E)-N-methoxy-1-phenyl-1-pyrrolidin-2-ylmethanimine.
| Compound Name | (E)-N-methoxy-1-phenyl-1-pyrrolidin-2-ylmethanimine |
|---|---|
| PubChem CID | 82396551 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (E)-N-methoxy-1-phenyl-1-pyrrolidin-2-ylmethanimine |
| SMILES | CO/N=C(\c1ccccc1)C1CCCN1 |
| InChI | InChI=1S/C12H16N2O/c1-15-14-12(11-8-5-9-13-11)10-6-3-2-4-7-10/h2-4,6-7,11,13H,5,8-9H2,1H3/b14-12+ |
| InChIKey | XHBIBAJCUFEWGH-WYMLVPIESA-N |
| XLogP | 1.79 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|