C25H36BN3O3 — CID 123465582
3-methyl-1-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-1-one (PubChem CID 123465582) has the molecular formula C25H36BN3O3 and a molecular weight of 437.39 g/mol. Its IUPAC name is 3-methyl-1-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-1-one.
| Compound Name | 3-methyl-1-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-1-one |
|---|---|
| PubChem CID | 123465582 |
| Molecular Formula | C25H36BN3O3 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 3-methyl-1-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-1-one |
| SMILES | CC(C)CC(=O)N1C2CC2CC1C1N=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CN1 |
| InChI | InChI=1S/C25H36BN3O3/c1-15(2)11-22(30)29-20-12-17(20)13-21(29)23-27-14-19(28-23)16-7-9-18(10-8-16)26-31-24(3,4)25(5,6)32-26/h7-10,15,17,20-21,23,27H,11-14H2,1-6H3 |
| InChIKey | HWCAZGSMEYCPFG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|