C23H35BN4O3 — CID 123928235
2-amino-3-methyl-1-[2-[4-[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 123928235) has the molecular formula C23H35BN4O3 and a molecular weight of 426.37 g/mol. Its IUPAC name is 2-amino-3-methyl-1-[2-[4-[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | 2-amino-3-methyl-1-[2-[4-[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 123928235 |
| Molecular Formula | C23H35BN4O3 |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 2-amino-3-methyl-1-[2-[4-[4-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | CC(C)C(N)C(=O)N1CCCC1C1N=C(c2ccc(B3OC(C)C(C)(C)O3)cc2)CN1 |
| InChI | InChI=1S/C23H35BN4O3/c1-14(2)20(25)22(29)28-12-6-7-19(28)21-26-13-18(27-21)16-8-10-17(11-9-16)24-30-15(3)23(4,5)31-24/h8-11,14-15,19-21,26H,6-7,12-13,25H2,1-5H3 |
| InChIKey | XAQWLAWELUVEEK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|