C27H38BN3O5 — CID 58310338
methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 58310338) has the molecular formula C27H38BN3O5 and a molecular weight of 495.43 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 58310338 |
| Molecular Formula | C27H38BN3O5 |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)C(C)C |
| InChI | InChI=1S/C27H38BN3O5/c1-17(2)23(30-25(33)34-7)24(32)31-14-8-9-22(31)21-15-19(16-29-21)18-10-12-20(13-11-18)28-35-26(3,4)27(5,6)36-28/h10-13,16-17,22-23H,8-9,14-15H2,1-7H3,(H,30,33)/t22-,23-/m0/s1 |
| InChIKey | VPADVJIIRQXVDA-GOTSBHOMSA-N |
| XLogP | 3.54 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|