C31H46BN3O5 — CID 90887665
methyl N-[1-[(2Z)-2-[3-ethyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-3H-pyridin-2-ylidene]-4-methylpyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 90887665) has the molecular formula C31H46BN3O5 and a molecular weight of 551.54 g/mol. Its IUPAC name is methyl N-[1-[(2Z)-2-[3-ethyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-3H-pyridin-2-ylidene]-4-methylpyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[1-[(2Z)-2-[3-ethyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-3H-pyridin-2-ylidene]-4-methylpyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 90887665 |
| Molecular Formula | C31H46BN3O5 |
| Molecular Weight | 551.54 g/mol |
| Exact Mass | 551.35 |
| IUPAC Name | methyl N-[1-[(2Z)-2-[3-ethyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-3H-pyridin-2-ylidene]-4-methylpyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCC1CCC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)=N/C1=C1/CC(C)CN1C(=O)C(NC(=O)OC)C(C)C |
| InChI | InChI=1S/C31H46BN3O5/c1-10-21-13-16-24(22-11-14-23(15-12-22)32-39-30(5,6)31(7,8)40-32)33-27(21)25-17-20(4)18-35(25)28(36)26(19(2)3)34-29(37)38-9/h11-12,14-15,19-21,26H,10,13,16-18H2,1-9H3,(H,34,37)/b27-25- |
| InChIKey | BIMKIRVWMCWBCP-RFBIWTDZSA-N |
| XLogP | 5.06 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|