C26H39BN4O3 — CID 123783238
2-amino-3-methyl-1-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-1-one (PubChem CID 123783238) has the molecular formula C26H39BN4O3 and a molecular weight of 466.44 g/mol. Its IUPAC name is 2-amino-3-methyl-1-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-1-one.
| Compound Name | 2-amino-3-methyl-1-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-1-one |
|---|---|
| PubChem CID | 123783238 |
| Molecular Formula | C26H39BN4O3 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 2-amino-3-methyl-1-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dihydro-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-1-one |
| SMILES | CC(C)C(N)C(=O)N1C2CCC(C2)C1C1N=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CN1 |
| InChI | InChI=1S/C26H39BN4O3/c1-15(2)21(28)24(32)31-19-12-9-17(13-19)22(31)23-29-14-20(30-23)16-7-10-18(11-8-16)27-33-25(3,4)26(5,6)34-27/h7-8,10-11,15,17,19,21-23,29H,9,12-14,28H2,1-6H3 |
| InChIKey | APPTUYIDKWVWCZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|