C29H40BN3O5 — CID 159122123
methyl N-[(2S)-3-methyl-1-oxo-1-[(1R,3S,4S)-3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-2-yl]carbamate (PubChem CID 159122123) has the molecular formula C29H40BN3O5 and a molecular weight of 521.47 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[(1R,3S,4S)-3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(1R,3S,4S)-3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 159122123 |
| Molecular Formula | C29H40BN3O5 |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(1R,3S,4S)-3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1[C@@H]2CC[C@@H](C2)[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)C(C)C |
| InChI | InChI=1S/C29H40BN3O5/c1-17(2)24(32-27(35)36-7)26(34)33-22-13-10-19(14-22)25(33)23-15-20(16-31-23)18-8-11-21(12-9-18)30-37-28(3,4)29(5,6)38-30/h8-9,11-12,16-17,19,22,24-25H,10,13-15H2,1-7H3,(H,32,35)/t19-,22+,24-,25-/m0/s1 |
| InChIKey | QZQCIEXPVOFCEI-UOYQKJQJSA-N |
| XLogP | 3.93 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|