C4H4N6 — CID 123871191
1-(triazol-1-yl)-1,2,4-triazole (PubChem CID 123871191) has the molecular formula C4H4N6 and a molecular weight of 136.12 g/mol. Its IUPAC name is 1-(triazol-1-yl)-1,2,4-triazole.
| Compound Name | 1-(triazol-1-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 123871191 |
| Molecular Formula | C4H4N6 |
| Molecular Weight | 136.12 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 1-(triazol-1-yl)-1,2,4-triazole |
| SMILES | c1cn(-n2cncn2)nn1 |
| InChI | InChI=1S/C4H4N6/c1-2-9(8-6-1)10-4-5-3-7-10/h1-4H |
| InChIKey | AIVCLLMCMATXKF-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.12 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |