C5H4N6O2 — CID 141178933
1-(4-nitropyrazol-1-yl)-1,2,4-triazole (PubChem CID 141178933) has the molecular formula C5H4N6O2 and a molecular weight of 180.13 g/mol. Its IUPAC name is 1-(4-nitropyrazol-1-yl)-1,2,4-triazole.
| Compound Name | 1-(4-nitropyrazol-1-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 141178933 |
| Molecular Formula | C5H4N6O2 |
| Molecular Weight | 180.13 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 1-(4-nitropyrazol-1-yl)-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cnn(-n2cncn2)c1 |
| InChI | InChI=1S/C5H4N6O2/c12-11(13)5-1-7-9(2-5)10-4-6-3-8-10/h1-4H |
| InChIKey | WYCARBNGSFECHK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.13 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|