C21H10F5N3 — CID 123874125
4-(2,3,4,5,6-pentafluorophenyl)-2,3-dipyridin-2-ylpyridine (PubChem CID 123874125) has the molecular formula C21H10F5N3 and a molecular weight of 399.32 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentafluorophenyl)-2,3-dipyridin-2-ylpyridine.
| Compound Name | 4-(2,3,4,5,6-pentafluorophenyl)-2,3-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 123874125 |
| Molecular Formula | C21H10F5N3 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 4-(2,3,4,5,6-pentafluorophenyl)-2,3-dipyridin-2-ylpyridine |
| SMILES | Fc1c(F)c(F)c(-c2ccnc(-c3ccccn3)c2-c2ccccn2)c(F)c1F |
| InChI | InChI=1S/C21H10F5N3/c22-16-15(17(23)19(25)20(26)18(16)24)11-7-10-29-21(13-6-2-4-9-28-13)14(11)12-5-1-3-8-27-12/h1-10H |
| InChIKey | FYWASQKLPGCEGO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|