C12H12N2OS2 — CID 123874586
4-cyclopropyl-5-methylsulfinyl-2-pyridin-3-yl-1,3-thiazole (PubChem CID 123874586) has the molecular formula C12H12N2OS2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-cyclopropyl-5-methylsulfinyl-2-pyridin-3-yl-1,3-thiazole.
| Compound Name | 4-cyclopropyl-5-methylsulfinyl-2-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 123874586 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 4-cyclopropyl-5-methylsulfinyl-2-pyridin-3-yl-1,3-thiazole |
| SMILES | CS(=O)c1sc(-c2cccnc2)nc1C1CC1 |
| InChI | InChI=1S/C12H12N2OS2/c1-17(15)12-10(8-4-5-8)14-11(16-12)9-3-2-6-13-7-9/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | PRWYFOLKZAZVQZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |