C22H18N2O5S — CID 1238746
3-[[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]amino]benzoic acid (PubChem CID 1238746) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is 3-[[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]amino]benzoic acid.
| Compound Name | 3-[[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1238746 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 3-[[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2cccc(S(=O)(=O)N3CCc4ccccc43)c2)c1 |
| InChI | InChI=1S/C22H18N2O5S/c25-21(23-18-8-3-7-17(13-18)22(26)27)16-6-4-9-19(14-16)30(28,29)24-12-11-15-5-1-2-10-20(15)24/h1-10,13-14H,11-12H2,(H,23,25)(H,26,27) |
| InChIKey | BDJQUMFXFGIMBB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |