C21H16N6O2S2 — CID 123874671
N-[2-[2-(3-amino-5-cyanophenyl)propanoylamino]-1,3-benzothiazol-6-yl]-1,3-thiazole-4-carboxamide (PubChem CID 123874671) has the molecular formula C21H16N6O2S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-[2-[2-(3-amino-5-cyanophenyl)propanoylamino]-1,3-benzothiazol-6-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[2-(3-amino-5-cyanophenyl)propanoylamino]-1,3-benzothiazol-6-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 123874671 |
| Molecular Formula | C21H16N6O2S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-[2-[2-(3-amino-5-cyanophenyl)propanoylamino]-1,3-benzothiazol-6-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(C(=O)Nc1nc2ccc(NC(=O)c3cscn3)cc2s1)c1cc(N)cc(C#N)c1 |
| InChI | InChI=1S/C21H16N6O2S2/c1-11(13-4-12(8-22)5-14(23)6-13)19(28)27-21-26-16-3-2-15(7-18(16)31-21)25-20(29)17-9-30-10-24-17/h2-7,9-11H,23H2,1H3,(H,25,29)(H,26,27,28) |
| InChIKey | GDCYBMDRTZLQEH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|