C27H28FN3O2S — CID 123876146
3-fluoro-4-[2-[5-[4-(oxan-4-yl)butyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyaniline (PubChem CID 123876146) has the molecular formula C27H28FN3O2S and a molecular weight of 477.61 g/mol. Its IUPAC name is 3-fluoro-4-[2-[5-[4-(oxan-4-yl)butyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyaniline.
| Compound Name | 3-fluoro-4-[2-[5-[4-(oxan-4-yl)butyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyaniline |
|---|---|
| PubChem CID | 123876146 |
| Molecular Formula | C27H28FN3O2S |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-fluoro-4-[2-[5-[4-(oxan-4-yl)butyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyaniline |
| SMILES | Nc1ccc(Oc2ccnc3cc(-c4ccc(CCCCC5CCOCC5)cn4)sc23)c(F)c1 |
| InChI | InChI=1S/C27H28FN3O2S/c28-21-15-20(29)6-8-24(21)33-25-9-12-30-23-16-26(34-27(23)25)22-7-5-19(17-31-22)4-2-1-3-18-10-13-32-14-11-18/h5-9,12,15-18H,1-4,10-11,13-14,29H2 |
| InChIKey | GFHSXQIDCREAIE-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|