C10H14FN — CID 123876492
5-(1-fluorobut-3-enyl)-2-methyl-3,4-dihydropyridine (PubChem CID 123876492) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is 5-(1-fluorobut-3-enyl)-2-methyl-3,4-dihydropyridine.
| Compound Name | 5-(1-fluorobut-3-enyl)-2-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 123876492 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 5-(1-fluorobut-3-enyl)-2-methyl-3,4-dihydropyridine |
| SMILES | C=CCC(F)C1=CN=C(C)CC1 |
| InChI | InChI=1S/C10H14FN/c1-3-4-10(11)9-6-5-8(2)12-7-9/h3,7,10H,1,4-6H2,2H3 |
| InChIKey | GIGCWJZCSAWUTA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|