C25H34ClN3O4SSi — CID 123876840
N-[1-[2-(4-chlorophenyl)-3-methoxybut-3-en-2-yl]indazol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide (PubChem CID 123876840) has the molecular formula C25H34ClN3O4SSi and a molecular weight of 536.17 g/mol. Its IUPAC name is N-[1-[2-(4-chlorophenyl)-3-methoxybut-3-en-2-yl]indazol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide.
| Compound Name | N-[1-[2-(4-chlorophenyl)-3-methoxybut-3-en-2-yl]indazol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide |
|---|---|
| PubChem CID | 123876840 |
| Molecular Formula | C25H34ClN3O4SSi |
| Molecular Weight | 536.17 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | N-[1-[2-(4-chlorophenyl)-3-methoxybut-3-en-2-yl]indazol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide |
| SMILES | C=C(OC)C(C)(c1ccc(Cl)cc1)n1ncc2c(N(COCC[Si](C)(C)C)S(C)(=O)=O)cccc21 |
| InChI | InChI=1S/C25H34ClN3O4SSi/c1-19(32-3)25(2,20-11-13-21(26)14-12-20)29-24-10-8-9-23(22(24)17-27-29)28(34(4,30)31)18-33-15-16-35(5,6)7/h8-14,17H,1,15-16,18H2,2-7H3 |
| InChIKey | GXBGYDFZFNVYHY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.17 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|