C25H34ClN3O5SSi — CID 70565947
methyl 2-(4-chlorophenyl)-2-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indazol-1-yl]butanoate (PubChem CID 70565947) has the molecular formula C25H34ClN3O5SSi and a molecular weight of 552.17 g/mol. Its IUPAC name is methyl 2-(4-chlorophenyl)-2-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indazol-1-yl]butanoate.
| Compound Name | methyl 2-(4-chlorophenyl)-2-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indazol-1-yl]butanoate |
|---|---|
| PubChem CID | 70565947 |
| Molecular Formula | C25H34ClN3O5SSi |
| Molecular Weight | 552.17 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | methyl 2-(4-chlorophenyl)-2-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indazol-1-yl]butanoate |
| SMILES | CCC(C(=O)OC)(c1ccc(Cl)cc1)n1ncc2c(N(COCC[Si](C)(C)C)S(C)(=O)=O)cccc21 |
| InChI | InChI=1S/C25H34ClN3O5SSi/c1-7-25(24(30)33-2,19-11-13-20(26)14-12-19)29-23-10-8-9-22(21(23)17-27-29)28(35(3,31)32)18-34-15-16-36(4,5)6/h8-14,17H,7,15-16,18H2,1-6H3 |
| InChIKey | IFVHGUPDRIVKIG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.17 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|