C28H35ClN2O5SSi — CID 70562147
methyl 4-(4-chlorophenyl)-4-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indol-1-yl]hex-2-ynoate (PubChem CID 70562147) has the molecular formula C28H35ClN2O5SSi and a molecular weight of 575.20 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-4-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indol-1-yl]hex-2-ynoate.
| Compound Name | methyl 4-(4-chlorophenyl)-4-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indol-1-yl]hex-2-ynoate |
|---|---|
| PubChem CID | 70562147 |
| Molecular Formula | C28H35ClN2O5SSi |
| Molecular Weight | 575.20 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-4-[4-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]indol-1-yl]hex-2-ynoate |
| SMILES | CCC(C#CC(=O)OC)(c1ccc(Cl)cc1)n1ccc2c(N(COCC[Si](C)(C)C)S(C)(=O)=O)cccc21 |
| InChI | InChI=1S/C28H35ClN2O5SSi/c1-7-28(17-15-27(32)35-2,22-11-13-23(29)14-12-22)30-18-16-24-25(30)9-8-10-26(24)31(37(3,33)34)21-36-19-20-38(4,5)6/h8-14,16,18H,7,19-21H2,1-6H3 |
| InChIKey | COYRUALGGLIEDR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.20 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|